Customs Tariff
Chapter 38
|
1
|
Heading No. |
Sub-heading No. |
Description of article |
Unit
|
Tariff value US $ (Per Metric Tonne) |
Basic Customs Duty (Standard) |
Exemption Notifications |
Basic Customs Duty (Preferential) |
Customs Education Cess |
Customs Secondary & Higher Education Cess |
Addl. Customs Duty/ Special CVD |
Additional Duty on High Speed Diesel Oil |
Additional Duty on Motor Spirit (Petrol) |
Additional duty on import of alcoholic liquors |
Anti-dumping Duty |
NATIONAL CALAMITY CONTINGENT DUTY |
Safeguard Duty |
Policy |
MRP Valuation |
Tariff Valuation |
Basic Excise Duty |
Exemption Notifications |
Excise Duties & Cess Leviable Under Miscellaneous Acts |
Additional Duties of Excise (Goods of Special Importance
Act) |
Additional Duty on Textile & Textile Articles |
Additional duty on High speed Diesel Oil |
Additional duty on Motor Spirit |
Special Additional duty on Motor Spirit & High speed
Diesel Oil |
Additional Duty on Pan Masala & Certain Tobacco
Products |
Special Excise Duty |
Education Cess |
Secondary & Higher Education Cess |
NATIONAL CALAMITY CONTINGENT DUTY |
|
2 |
Effective rate of duty
|
Exemption Notification related to specific heading |
Exemption Notification related to Chapter -38 |
Exemption Notification related to any chapter heading |
General Exemptions |
Education Cess |
Exemption from Customs Education Cess |
Secondary & Higher Education Cess |
Exemption from Customs Secondary & Higher Education
Cess |
Additional Custom Duty |
Exemption from Additional Custom Duty |
Additional Duty |
Exemption on high speed diesel oil from additional duty. |
Additional Duty |
Additional duty on alcoholic liquors |
Exemption from additional duty on alcoholic liquors |
NCCD
|
Exemption from NCCD |
Abatement as a percentage of retail sale price |
Notifications |
|
|
Effective rate of Duty |
Exemption related to Specific Heading |
Exemption related to chapter. 38 |
Exemption related Any chapter |
General Exemption |
|
Duty |
Exemption Notification |
Duty |
Exemption Notification |
|
|
Special Additional duty on Motor Spirit & High speed
Diesel Oil
|
Exemption from Special Additional duty on Motor Spirit
& High speed Diesel Oil |
|
Special Excise Duty |
Exemption from Special Excise Duty |
NCCD |
Exemption from NCCD |
||||||||||||
|
3 |
3811 |
|
Anti-knock preparations, oxidation
inhibitors, gum inhibitors, viscosity improvers, anti-corrosive preparations
and other prepared additives, for mineral oils (including gasoline) or for other
liquids used for the same purposes as mineral oils |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||||||
|
4 |
|
|
- Anti-knock preparations: |
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||||
|
5 |
|
3811 11 00 |
--Based on lead compounds |
Kg. |
10% |
... |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
6 |
|
3811 19 00 |
--Other |
Kg. |
10% |
... |
2% |
1% |
4% |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
7 |
|
|
- Additives for lubricating
oils: |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||
|
8 |
|
3811 21 00 |
--Containing petroleum oils or oils obtained from bituminous
minerals |
Kg. |
10% |
... |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
9 |
|
3811 29 00 |
--Other |
Kg. |
10% |
... |
2% |
1% |
4% |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
10 |
|
3811 90 00 |
-Other |
Kg. |
10% |
... |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
11 |
3812 |
|
Prepared rubber accelerators;
compound plasticisers for rubber or plastics, not elsewhere specified or included;
anti-oxidising preparations and other compound stabilisers for rubber or
plastics |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||||
|
12 |
|
3812 10 00 |
- Prepared rubber
accelerators |
Kg. |
10% |
7.5% |
10%
|
2% |
1% |
4% |
Notification No. 87/2005-Cus
Dated 27/9/2005 Notification No.
94/2005-Cus Dated 20/10/2005 Notification No. 133/2008-Cus Dated 12/12/2008 Notification No. 74/2010-Cus Dated 7/7/2010 Notification No. 67/2011-Cus Dated 28/07/2011 |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||
|
13 |
3812 20 |
|
- Compound plasticisers for rubber
or plastics : |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||||||
|
14 |
3812 20 10 |
-- Phthalate plasticisers |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
Notification
No. 87/2005-Cus Dated 27/9/2005 Notification No. 94/2005-Cus Dated 20/10/2005 Notification No. 133/2008-Cus Dated 12/12/2008 Notification No. 74/2010-Cus Dated 7/7/2010 Notification No. 67/2011-Cus Dated 28/07/2011 |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
15 |
3812 20 90 |
-- Other |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
Notification
No. 87/2005-Cus Dated 27/9/2005 Notification No. 94/2005-Cus Dated 20/10/2005 Notification No. 133/2008-Cus Dated 12/12/2008 Notification No. 74/2010-Cus Dated 7/7/2010 Notification No. 67/2011-Cus Dated 28/07/2011 |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
16 |
3812 30 |
|
- Anti-oxidising preparations and
other compound stabilisers for rubber or plastics : |
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||||
|
3812 31 00 |
--Mixture of obligomers of
2,2,4-trimethyl-1,2-dihydroquinoline(TMQ) |
Kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3812
39 |
--other: |
||||||||||||||||||||||||||||||||||||||||||||||||||||
|
17 |
3812 39 10 |
-- Anti-oxidants for rubber |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
Notification
No. 57/2016-Cus(ADD) Dated 31-12-2016 Notification No. 115/2001-Cus Dated 02-11-2001 Notification No. 58/2002-Cus Dated 05-06-2002 Notification No. 87/2005-Cus Dated 27/9/2005 Notification No. 94/2005-Cus Dated 20/10/2005 Notification No. 133/2008-Cus Dated 12/12/2008 Notification No. 74/2010-Cus Dated 7/7/2010 Notification No. 67/2011-Cus Dated 28/07/2011 |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
18 |
3812 39 20 |
-- Softeners for rubber |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
Notification
No. 57/2016-Cus(ADD) Dated 31-12-2016 Notification No. 115/2001-Cus Dated 02-11-2001 Notification No. 58/2002-Cus Dated 05-06-2002 Notification No. 87/2005-Cus Dated 27/9/2005 Notification No. 94/2005-Cus Dated 20/10/2005 Notification No. 133/2008-Cus Dated 12/12/2008 Notification No. 74/2010-Cus Dated 7/7/2010 Notification No. 67/2011-Cus Dated 28/07/2011 |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
19 |
3812
39 30 |
--
Vulcansing agents for rubber |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
Notification
No. 57/2016-Cus(ADD) Dated 31-12-2016 Notification No. 115/2001-Cus Dated 02-11-2001 Notification No. 58/2002-Cus Dated 05-06-2002 Notification No. 87/2005-Cus Dated 27/9/2005 Notification No. 94/2005-Cus Dated 20/10/2005 Notification No. 133/2008-Cus Dated 12/12/2008 Notification No. 74/2010-Cus Dated 7/7/2010 Notification No. 67/2011-Cus Dated 28/07/2011 Notification No. 92/2011-Cus Dated 20/09/2011 |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
20 |
3812 39 90 |
-- Other |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
Notification
No. 57/2016-Cus(ADD) Dated 31-12-2016 Notification No. 115/2001-Cus Dated 02-11-2001 Notification No. 58/2002-Cus Dated 05-06-2002 Notification No. 87/2005-Cus Dated 27/9/2005 Notification No. 94/2005-Cus Dated 20/10/2005 Notification No. 133/2008-Cus Dated 12/12/2008 Notification No. 74/2010-Cus Dated 7/7/2010 Notification No. 67/2011-Cus Dated 28/07/2011 |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
21 |
|
3813 00 00 |
Preparations and charges for fire-extinguishers;
charged fire-extinguishing grenades |
Kg. |
10% |
... |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
22 |
3814 |
Organic composite solvents and thinners,
not elsewhere specified or included; prepared paint or varnish removers |
|
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||||||||
|
23 |
3814 00 |
- Organic composite solvents and
thinners, not elsewhere specified or included; prepared paint or varnish
removers : |
|
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||||||||
|
24 |
3814 00 10 |
-- Organic composite solvents and
thinners, not elsewhere specified or included |
Kg. |
10% |
... |
2% |
1% |
4% |
Free |
35
Old[38] |
Notification No. 49/2008-CE (NT) Dated
24/12/2008 Sl.No.48 Old[Notification No. 14/2008-CE (NT) Dated 1/3/2008 S.No.48] |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
25 |
3814 00 20 |
-- Prepared paint or varnish removers |
Kg. |
10% |
... |
2% |
1% |
4% |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
26 |
3815 |
|
Reaction initiators, reaction
accelerators and catalytic preparations, not elsewhere specified or
included |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||
|
27 |
|
|
- Supported catalysts: |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||
|
28 |
|
3815 11 00 |
--With nickel or nickel compounds as the active
substance |
Kg. |
10% |
7.5% or Nil |
Notification No. 12/2012-Cus
Dated 17-03-2012 Sl. No. 228, 211A |
10%
|
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||
|
29 |
3815 12 |
|
-- With precious metal or precious
metal compounds as the active substance : |
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||||
|
30 |
3815 12 10 |
-- Platinum or palladium catalysts
with a base of activated carbon |
Kg. |
10% |
7.5% or Nil |
Notification No.
12/2012-Cus Dated 17-03-2012 Sl. No. 228, 211A |
10%
|
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
31 |
3815 12 90 |
-- Other |
Kg. |
10% |
7.5% or Nil |
Notification No.
12/2012-Cus Dated 17-03-2012 Sl. No. 228, 211A |
10%
|
2% |
1% |
4% |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
32 |
|
3815 19 00 |
-- Other |
Kg. |
10% |
7.5% or Nil |
Notification No.
12/2012-Cus Dated 17-03-2012 Sl. No. 228, 211A |
... |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||
|
33 |
|
3815 90 00 |
-Other |
Kg. |
10% |
7.5% or Nil |
Notification No.
12/2012-Cus Dated 17-03-2012 Sl. No. 228, 211A |
... |
2% |
1% |
4% |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||
|
34 |
|
3816 00 00 |
Refractory cements, mortars,
concretes and similar compositions, other than products of Heading No.
3801 |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
35 |
3817 |
|
Mixed alkylbenzenes and mixed alkylnaphthalenes,
other than those of Heading No. 2707 or 2902 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||||
|
36 |
3817 00 |
- Mixed alkylbenzenes and mixed alkylnaphthalenes,
other than those of Heading No. 2707 or 2902 : |
|
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||||||||
|
37 |
- Mixed alkylbenzenes : |
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||||||
|
38 |
3817 00 11 |
-- Linear alkylbenzenes |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
Notification No.
|
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
39 |
|
3817 00 19 |
- Other |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
40 |
|
3817 00 20 |
-Mixed alkylnaphthalenes |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
41 |
3818 |
Chemical elements doped for use in
electronics, in the form of discs, wafers or similar forms; chemical
compounds doped for use in electronics |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||||||
|
42 |
3818 00 |
- Chemical elements doped for use
in electronics, in the form of discs, wafers or similar forms; chemical
compounds doped for use in electronics : |
|
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||||||||
|
43 |
3818 00 10 |
-- Undefused silicon wafers |
Kg. |
Free |
Nil |
... |
2% |
1% |
4% |
Free |
|
12% |
Nil |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
44 |
3818 00 90 |
-- Other |
Kg. |
Free |
Nil |
... |
2% |
1% |
4% |
Free
|
|
12% |
Nil |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
45 |
3819 |
Hydraulic brake fluids and other
prepared liquids for hydraulic transmission, not containing or containing
less than 70% by weight of petroleum oils or oils obtained from bituminous
minerals |
|
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||||||||
|
46 |
3819 00 10 |
-- Hydraulic brake fluids |
Kg. |
10% |
... |
2% |
1% |
4% |
Free |
35
Old[38] |
Notification No. 49/2008-CE (NT) Dated
24/12/2008 Sl.No.49 Old[Notification No. 14/2008-CE (NT) Dated 1/3/2008 S.No.49] |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
47 |
3819 00 90 |
-- Other |
Kg. |
10% |
... |
2% |
1% |
4% |
Free
|
35
Old[38] |
Notification No. 49/2008-CE (NT) Dated
24/12/2008 Sl.No.49 Old[Notification No. 14/2008-CE (NT) Dated 1/3/2008 S.No.49] |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
48 |
|
3820 00 00 |
Anti-freezing preparations and prepared
de-icing fluids |
Kg. |
10% |
... |
2% |
1% |
4% |
Free |
35
Old[38] |
Notification No. 49/2008-CE (NT) Dated
24/12/2008 Sl.No.50 Old[Notification No. 14/2008-CE (NT) Dated 1/3/2008 S.No.50] |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||
|
49 |
|
3821 00 00 |
PREPARED CULTURE MEDIA FOR DEVELOPMENT
OR MAINTENANCE OF MICRO- ORGANISMS (INCLUDING VIRUSES AND THE LIKE) OR OF
PLANT, HUMAN OR ANIMAL CELLS |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
50 |
3822 |
Diagnostic or laboratory reagents
on a backing and prepared diagnostic or laboratory reagents whether or not on
a backing, other than those of heading No. 3002 or 3006; certified reference
materials |
|
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||||||||
|
51 |
3822 00 |
- Diagnostic or laboratory
reagents on a backing and prepared diagnostic or laboratory reagents whether
or not on a backing, other than those of heading No. 3002 or 3006 : |
|
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||||||||
|
52 |
- For medical diagnosis : |
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||||||
|
53 |
3822 00 11 |
-- Pregnancy confirmation reagents |
Kg. |
10% |
5% |
... |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
54 |
3822 00 12 |
-- Reagents for diagnosing AIDS |
Kg. |
10% |
5% |
... |
2% |
1% |
4% |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
55 |
3822 00 19 |
-- Other |
Kg. |
10% |
5% |
... |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
56 |
3822 00 90 |
-- Other |
Kg. |
4[20%]
old[10%] |
5% |
... |
2% |
1% |
4% |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
57 |
3823 |
|
Industrial Monocarboxylic fatty
acids; Acid oils from refining; industrial fatty alcohols |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||
|
58 |
|
|
- Industrial monocarboxylic
fatty acids; acid oils from refining: |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||
|
3823 11 00 |
-- Stearic acid |
kg. |
30% |
- |
|||||||||||||||||||||||||||||||||||||||||||||||||
|
65 |
|
3823 12 00 |
--Oleic acid |
Kg. |
30%
|
15% or Nil |
Notification No.
12/2012-Cus Dated 17-03-2012 Sl. No.,230 230A |
... |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||
|
66 |
|
3823 13 00 |
--Tall oil fatty acids |
Kg. |
30%
|
15% or Nil |
Notification No.
12/2012-Cus Dated 17-03-2012 Sl. No.,230 230A |
... |
2% |
1% |
4% |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||
|
67 |
|
3823 19 00 |
--Other |
Kg. |
30%
|
15% or Nil |
Notification No.
12/2012-Cus Dated 17-03-2012 Sl. No.,230 230A |
... |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||
|
368 |
3823 70 |
|
- Industrial fatty alcohols : |
|
2% |
1% |
4% |
|
Free
|
|
|
||||||||||||||||||||||||||||||||||||||||||
|
69 |
3823 70 10 |
-- Cetyl alcohol |
Kg. |
50%
|
15%
|
... |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
70 |
3823 70 20 |
-- Lauryl alcohol |
Kg. |
50%
|
15%
|
... |
2% |
1% |
4% |
Notification No.
03/2014-Customs (SG) Dated 28/08/2014 Notification No. 1/2015-Customs (SG) Dated 13/03/2015
|
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
71 |
3823 70 30 |
-- Oleyl alcohol |
Kg. |
50%
|
15%
|
... |
2% |
1% |
4% |
Notification No.
03/2014-Customs (SG) Dated 28/08/2014 Notification No. 1/2015-Customs (SG) Dated 13/03/2015
|
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
72 |
3823 70 40 |
-- Stearyl alcohol |
Kg. |
50%
|
15%
|
... |
2% |
1% |
4% |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
73 |
3823 70 90 |
-- Other |
Kg. |
50%
|
15%
|
... |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
74 |
3824 |
|
Prepared binders for foundry
moulds or cores; chemical products and preparations of the chemical or allied
industries (including those consisting of mixtures of natural products), not elsewhere
specified or included; residual products of the chemical or allied
industries, not elsewhere specified or included |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||
|
75 |
|
3824 10 00 |
- Prepared binders for foundry
moulds or cores |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
76 |
|
3824 30 00 |
- Non-agglomerated metal carbides
mixed together or with metallic binders |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||
|
77 |
3824 40 |
|
- Prepared additives for cements,
mortars or concretes : |
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||||
|
78 |
3824 40 10 |
-- Damp proof or water proof
compounds |
kg. |
10% |
7.5% |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
79 |
3824 40 90 |
-- Other |
kg. |
10% |
7.5% |
2% |
1% |
4% |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
80 |
3824 50 |
|
- Non-refractory mortars and
concretes : |
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||||
|
81 |
3824 50 10 |
-- Concretes ready to use known as
"Ready-mix Concrete (RMC)" |
kg. |
10% |
7.5% |
2% |
1% |
0% |
Free |
|
6% |
2% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
82 |
3824 50 90 |
-- Other |
kg. |
10% |
7.5% |
2% |
1% |
4% |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
83 |
3824 60 |
|
- Sorbitol other than that of
sub-heading No. 2905 44 : |
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||||
|
84 |
3824 60 10 |
-- In aqueous solution |
Kg. |
30%
|
20%
|
... |
2% |
1% |
4% |
Free |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
85 |
3824 60 90 |
-- Other |
Kg. |
30%
|
20%
|
... |
2% |
1% |
4% |
Free
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||
|
86 |
|
|
- Mixtures containing halogenated derivatives
of methane, ethane or propane: |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||
|
87 |
3824 71 00 |
--Containing chlorofluorocarbons (CFCs), whether or not containing
hydrochlorofluoro-carbons (HCFCs), perfluorocarbons (PFCs) or
hydrofluorocarbons(HFCs) |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
88 |
3824 72 00 |
-- Containing
bromochlorodifluoromethane, bromotrifluoromethane or
dibromotetrafluoro-ethanes |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
89 |
3824 73 00 |
-- Containing
hydrobromofluorocarbons(HBFCs) |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
90 |
3824 74 00 |
--Containing hydrochlorofluorocarbons(HCFCs), whether or not
containing perfluorocarbons (PFCs) or hydrofluorocarbons (HFCs), but not
containing chlorofluorocarbons(CFCs) |
kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
91 |
3824 75 00 |
-- Containing carbon tetrachloride |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
92 |
3824 76 00 |
-- Containing 1,1,1-trichloroethane
(methyl chloroform) |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
93 |
3824 77 00 |
-- Containing bromomethane (methyl
bromide) or bromochloromethane |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
94 |
3824 78 00 |
-- Containing perfluorocarbons
(PFCs) or hydrofluorocarbons (HFCs), but not containing chlorofluorocarbons (CFCs)
or hydrochlorofluorocarbons (HCFCs) |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
95 |
3824 79 00 |
--Other |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
96 |
- Goods specified in Sub-heading Note 3 to this Chapter: |
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||||||
|
97 |
3824 81 00 |
--Containing oxirane (ethylene
oxide) |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
98 |
3824 82 00 |
--Containing polychlorinated
biphenyls (PCBs), polychlorinated terphenyls (PCTs) or polybrominated
biphenyls (PBBs) |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
99 |
3824 83 00 |
-- Containing tris(2,
3-dibromopropyl) phosphate |
Kg. |
10% |
7.5% |
... |
2% |
1% |
4% |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
3824 84 00 |
--
Containing aldrin (ISO), camphechlor
(ISO) (toxaphene), chlordane (ISO), chlordecone (ISO), DDT (ISO) (clofenotane (INN), 1, 1, 1- trichloro-2, 2-bis(p-chlorophenyl)ethane),
dieldrin (ISO, INN), endosulfan (ISO), endrin (ISO), heptachlor
(ISO) or mirex (ISO) |
kg. |
10% |
- |
|||||||||||||||||||||||||||||||||||||||||||||||||
|
3824 85 00 |
--
Containing 1, 2, 3, 4, 5,
6-hexachlorocyclohexane (HCH (ISO)), including lindane (ISO, INN) |
kg. |
10% |
- |
|||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
86 00 |
-- Containing pentachlorobenzene (ISO) or
hexachlorobenzene (ISO) |
kg. |
10% |
- |
|||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
87 00 |
Containing perflurooctane
sulphonic acid,its salts,perflurooctane sulphonamidesor perflurooctane
sulphonyl fluorine |
kg |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
88 00 |
- - Containing tetra-, penta-,
hexa-, hepta- or octabromodiphenyl ethers |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824 91 00 |
- - Mixtures and preparations consisting mainly of (5-ethyl-2-methyl-2-oxido-1, 3, 2-dioxaphosphinan-5-yl)methyl methyl methylphosphonate and bis[(5-ethyl-2-methyl-2-oxido-1, 3, 2-dioxaphosphinan-5-yl) methyl] methylphosphonate: |
1kg. |
110% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 |
- - Other: |
||||||||||||||||||||||||||||||||||||||||||||||||||||
|
- - - Ammoniacal gas liquors and spent oxide produced in coal gas purification, case hardening compound, heat transfer salts; mixture of diphenyl and diphenyl oxide as heat transfer medium, mixed polyethylene glycols; salts for curing or salting, surface tension reducing agents: |
|||||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 11 |
- - - - Ammoniacal gas liquors and spent oxide produced in coal gas purification |
kg. |
10% |
- |
|||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 12 |
- - - - Case hardening compound |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824 99 13 |
-
- - - Heat
transfer salts |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 14 |
- - - - Mixture of diphenyl and
diphenyl oxide as heat transfer medium |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 15 |
- - - - Mixed polyethylene glycols |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 16 |
- - - - Salts for curing or salting |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 17 |
- - - - Surface tension reducing
agents |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
- - - Electroplating salts; water treatment chemicals; ion exchanger, correcting fluid; precipitated silica and silica gel; oil well chemical: |
|||||||||||||||||||||||||||||||||||||||||||||||||||||
|
---Electroplating salts, Water treatment chemicals; ion
exchanger (INN), Correcting fluid, Precipitated silica and silica gel, Oil
well chemical |
|||||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 21 |
- - - - Electroplating salts |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824 99 22 |
- - - - Water treatment chemicals; ion exchanger (INN) such as permiutits, zero-lites |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 23 |
-
- - - Gramaphone records making material |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 24 |
- - - - Correcting fluid |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 25 |
- - - -Precipitated silica and
silica gel |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 26 |
- - - - Oil well chemical |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
- - - Mixture containing perhalogenated derivatives of acyclic hydrocarbons containing two or more different halogens other than chlorine and fluorine; ferrite powder; capacitor fluids - PCB type; dipping oil for treatment of grapes; Poly brominated biphenyls, poly chlorinated biphenyls, Poly chlorinated terphenyls, crocidolite; goods of a kind known as “hazardous waste”; phosphogypsum: |
|||||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 31 |
- - - - Mixture containing perhalogenated derivatives of acyclic hydrocarbons containing two or more different halogens other than chlorine and fluorine |
||||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 32 |
- - - - Ferrite powder |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 33 |
- - - - Capacitor
fluids - PCB type |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 34 |
-
- - - Dipping oil for treatment of grapes |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824 99 35 |
- - - - Poly brominated biphenyls, poly chlorinated biphenyls, Poly chlorinated terphenyls, crocidolite |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 36 |
- - - - Goods of a kind known as
“hazardous waste” |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 37 |
- - - - Phosphogypsum |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824 99 38 |
- - - - Phosphonic Acid, Methyl-compound with (aminoimino methyl) urea (1: 1) |
kg. |
10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
3824
99 90 |
Other |
kg. |
417.5%]
old[10% |
||||||||||||||||||||||||||||||||||||||||||||||||||
|
126 |
3825 |
Residual products of the chemical or
allied industries, not elsewhere specified or included; municipal waste;
sewage sludge; other wastes specified in Note 6 to this chapter |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||||||||
|
127 |
3825 10 00 |
-- Municipal waste |
Kg. |
10% |
... |
2% |
1% |
4% |
Restricted |
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||
|
128 |
3825 20 00 |
-- Sewage sludge |
Kg. |
10% |
... |
2% |
1% |
4% |
Restricted |
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||
|
129 |
3825 30 00 |
-- Clinical waste |
Kg. |
10% |
... |
2% |
1% |
4% |
Restricted |
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||
|
130 |
- Waste organic solvents : |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||||||||
|
131 |
3825 41 00 |
-- Halogenated |
Kg. |
10% |
... |
2% |
1% |
4% |
Restricted |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
132 |
3825 49 00 |
-- Other |
Kg. |
10% |
... |
2% |
1% |
4% |
Restricted |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
133 |
3825 50 00 |
-- Wastes of metal pickling liquors,
hydraulic fluids, brake fluids and antifreeze fluids |
Kg. |
10% |
... |
2% |
1% |
4% |
Restricted |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
134 |
- Other wastes from chemical or
allied industries : |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
||||||||||||||||||||||||||||||||||||||
|
135 |
3825 61 00 |
-- Mainly containing organic
constituents |
Kg. |
10% |
... |
2% |
1% |
4% |
Restricted |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
136 |
3825 69 00 |
-- Other |
Kg. |
10% |
... |
2% |
1% |
4% |
Restricted |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
137 |
3825 90 00 |
-- Other |
Kg. |
10% |
... |
2% |
1% |
4% |
Restricted |
|
12% |
|
|
|
|
|
|
|
|
|
|
|
|||||||||||||||||||||||||||||||
|
|
|
3826 00 00 |
-- Biodiesel and mixtures
thereof, not containing or containing less than 70% by weight of petroleum
oils and oils obtained from bituminous minerals |
Kg. |
10% |
|
... |
2% |
1% |
4% |
|
|
|
|
|
|
|
|
|
|
|
|
12% |
|
|
|
|
|
|
|
|
|
|
|
1. Inserted vide Notification No. 109/2008-Cus (NT) Dated 24/9/2008
2. Refer Vide Notification No. 07/2018-Custom (ADD) Dated 13/03/2018
3. Refer Vide Notification No. 28/2018-Customs (ADD) Dated 25/05/2018
4. Substituted Vide Notification No. 48 /2018-Customs Dated 20/06/2018