Central Excise Tariff 2007-08
Chapter 38
|
Heading No. |
Description of article |
Unit |
Rate of duty |
|
|
(1) |
|
(2) |
(3) |
(4) |
|
3801 |
|
Artificial graphite; colloidal or semi-colloidal graphite; preparations based on graphite or other carbon in the form of pastes, blocks, plates or other semi-manufactures |
|
|
|
|
3801 10 00 |
- Artificial graphite |
Kg. |
16% |
|
|
3801 20 00 |
- Colloidal or semi-colloidal graphite |
Kg. |
16% |
|
|
3801 30 00 |
- Carbonaceous pastes for electrodes and similar pastes for furnace linings |
Kg. |
16% |
|
|
3801 90 00 |
-Other |
Kg. |
16% |
|
3802 |
|
Activated carbon; activated natural mineral products; animal black, including spent animal black |
|
|
|
|
3802 10 00 |
- Activated carbon |
Kg. |
16% |
|
3802 90 |
|
-Other : |
|
|
|
|
|
--- Activated natural mineral products : |
|
|
|
|
3802 90 11 |
---- Activated alumina |
Kg. |
16% |
|
|
3802 90 12 |
---- Activted bauxite |
Kg. |
16% |
|
|
3802 90 19 |
---- Other |
Kg. |
16% |
|
|
3802 90 20 |
--- Animal black (for example bone black, ivory black), including spent animal black |
Kg. |
16% |
|
3803 00 00 |
|
Tall oil, whether or not refined |
Kg. |
16% |
|
3804 |
|
Residual lyes from the manufacture of wood pulp,whether or not concentrated, desugared or chemically treated, including lignin sulphonates, but excluding tall oil of Heading No. 3803 |
|
|
|
3804 00 |
|
- Residual lyes from the manufacture of wood pulp,whether or not concentrated, desugared or chemically treated, including lignin sulphonates, but excluding tall oil of Heading No. 3803 : |
|
|
|
|
3804 00 10 |
--- Lignin sulphonates |
Kg. |
16% |
|
|
3804 00 20 |
--- Concentrated sulphate lye |
Kg. |
16% |
|
|
3804 00 90 |
--- Other |
Kg. |
16% |
|
3805 |
|
Gum, wood or sulphate turpentine and other terpenic oils produced by the distillation or other treatment of coniferous woods; crude dipentene; sulphite turpentine and other crude para-cymene; pine oil containing alpha-terpineol as the main constituent |
|
|
|
3805 10 |
|
- Gum, wood or sulphate turpentine oils : |
|
|
|
|
3805 10 10 |
--- Wood turpentine oil and spirit of turpentine |
Kg. |
16% |
|
|
3805 10 20 |
--- Gum turpentine oil |
Kg. |
16% |
|
|
3805 10 30 |
--- Sulphate turpentine oil |
Kg. |
16% |
|
3805 90 |
|
- Other : |
|
|
|
|
3805 90 10 |
--- Terpenic oils produced by the distillation or other treatment of coniferous woods |
Kg. |
16% |
|
|
3805 90 20 |
--- Crude dipentene |
Kg. |
16% |
|
|
3805 90 30 |
--- Sulphite turpentine |
Kg. |
16% |
|
|
3805 90 90 |
--- Other |
Kg. |
16% |
|
3806 |
|
Rosin and resin acids, and derivatives thereof; rosin spirit and rosin oils; run gums |
|
|
|
3806 10 |
|
- Rosin and resin acids : |
|
|
|
|
3806 10 10 |
--- Gum rosin |
Kg. |
16% |
|
|
3806 10 90 |
--- Other |
Kg. |
16% |
|
|
3806 20 00 |
- Salts of rosin, of resin acids or of derivatives of rosin or resin acids, other than salts of rosin adducts |
Kg. |
16% |
|
|
3806 30 00 |
- Easter gums |
Kg. |
16% |
|
3806 90 |
|
- Other : |
|
|
|
|
3806 90 10 |
-- Run gums |
Kg. |
16% |
|
|
3806 90 90 |
-- Other |
Kg. |
16% |
|
3807 |
|
Wood tar; wood tar oils; wood creosote, wood naphtha; vegetable pitch; brewers' pitch and similar preparations based on rosin, resin acids or on vegetable pitch |
|
|
|
3807 00 |
|
- Wood tar; wood tar oils; wood creosote, wood naphtha; vegetable pitch; brewers' pitch and similar preparations based on rosin, resin acids or on vegetable pitch : |
|
|
|
|
3807 00 10 |
--- Wood tar |
Kg. |
16% |
|
|
3807 00 20 |
--- Wood tar oils, wood creosote, wood naphtha |
Kg. |
16% |
|
|
3807 00 30 |
--- Vegetable pitch, brewers' pitch and similar preparations based on rosin, resin acids or vegetable pitch |
Kg. |
16% |
|
3808 |
|
Insecticides, rodenticides, fungicides, herbicides, anti-sprouting products and plant-growth regulators, disinfectants and similar products, put up in forms or packings for retail sale or as preparations or articles (for example, sulphur- treated bands, wicks and candles, and fly-papers) |
|
|
|
3808 50 |
|
Goods specified in Sub-heading Note 1 to this Chapter, namely:— aldrin (ISO); binapacryI (ISO); camphechlor (ISO) (toxaphene); captafol (ISO); chlordane (ISO); chlordimeform (ISO); chlorobenzilate (ISO);DDT (ISO) (clofenotane (INN), 1,1,1-trichloro-2,2- bis(pchlorphenyl) ethane); dieldrin (ISO,INN), dinoseb (ISO), its salts or its esters; ethylene dibromide (ISO) (1,2-dibromoethane); ethylene dichloride(ISO) (1,2-dichloroethane); fluoroacetamide (ISO); heptachlor (ISO); hexachlorobenzene (ISO); 1,2,3,4,5,6 – exachlorocyclohexane (HCH (ISO)), including lindane (ISO, INN); mercury compounds; methamidophos (ISO); monocrotophos (ISO); oxirane (ethylene oxide); parathion (ISO); parathion-methyl (ISO) (methyl-parathion); pentachlorophenol (ISO); phosphamidon (ISO); 2,4,5-T (ISO) (2,4,5-trichlorophenoxyacetic acid), its salts or its esters: |
|
|
|
|
3808 50 00 |
- Aldrin (ISO); binapacryI (ISO); camphechlor (ISO) (toxaphene); captafol (ISO); chlordane (ISO); chlordimeform (ISO); chlorobenzilate (ISO);DDT (ISO) (clofenotane (INN), 1,1,1-trichloro-2,2- bis(pchlorphenyl) ethane); dieldrin (ISO,INN), dinoseb (ISO), its salts or its esters; ethylene dibromide (ISO) (1,2-dibromoethane); ethylene dichloride(ISO) (1,2-dichloroethane); fluoroacetamide (ISO); heptachlor (ISO); hexachlorobenzene (ISO); 1,2,3,4,5,6 – exachlorocyclohexane (HCH (ISO)), including lindane (ISO, INN); mercury compounds; methamidophos (ISO); monocrotophos (ISO); oxirane (ethylene oxide); parathion (ISO); parathion-methyl (ISO) (methyl-parathion); pentachlorophenol (ISO); phosphamidon (ISO); 2,4,5-T (ISO) (2,4,5-trichlorophenoxyacetic acid), its salts or its esters |
Kg. |
16% |
|
|
|
- Other: |
|
|
|
3808 91 |
|
-- Insecticides: |
|
|
|
|
3808 91 11 |
---- Aluminium phosphite (for example phostoxin) |
Kg. |
16% |
|
|
3808 91 12 |
---- Calcium cyanide |
Kg. |
16% |
|
|
3808 91 13 |
---- D.D.V.P. |
Kg. |
16% |
|
|
3808 91 21 |
---- Diaginal |
Kg. |
16% |
|
|
3808 91 22 |
---- Methyl bromide |
Kg. |
16% |
|
|
3808 91 23 |
---- Dimethoate, technical grade |
Kg. |
16% |
|
|
3808 91 24 |
---- Melathion |
Kg. |
16% |
|
|
3808 91 31 |
---- Endosulphan, technical grade |
Kg. |
16% |
|
|
3808 91 32 |
---- Quinal phos |
Kg. |
16% |
|
|
3808 91 33 |
---- Isoproturon |
Kg. |
16% |
|
|
3808 91 34 |
---- Fenthion |
Kg. |
16% |
|
|
3808 91 35 |
---- Cipermethrin, technical grade |
Kg. |
16% |
|
|
3808 91 36 |
---- Allethrin |
Kg. |
16% |
|
|
3808 91 37 |
---- Synthetic pyrethrum |
Kg. |
16% |
|
|
|
-- Other: |
|
|
|
|
3808 91 91 |
---- Repellants for insects such as flies, mosquito |
Kg. |
16% |
|
|
3808 91 92 |
---- Paper impregnated or coated with insecticides such as D.D.T. coated paper |
Kg. |
16% |
|
|
3808 91 99 |
--- Other |
Kg. |
16% |
|
3808 92 |
|
-- Fungicides: |
|
|
|
|
3808 92 10 |
--- Maneb |
Kg. |
16% |
|
|
3808 92 20 |
--- Sodium penta chlorophenate (santrobrite) |
Kg. |
16% |
|
|
3808 92 30 |
--- Thiram (tetramethyl thiuram disulphide) |
Kg. |
16% |
|
|
3808 92 40 |
--- Zineb |
Kg. |
16% |
|
|
3808 92 50 |
--- Copper oxychloride |
Kg. |
16% |
|
|
3808 92 90 |
--- Other |
Kg. |
16% |
|
3808 93 |
|
-- Herbicides, anti-sprouting products and plant-growth regulators: |
|
|
|
|
3808 93 10 |
--- Chloromethyl phenozy acetic acid (M.C.P.A) |
Kg. |
16% |
|
|
3808 93 20 |
--- 2:4 Dichloro phenoy acetic acid and its esters |
Kg. |
16% |
|
|
3808 93 30 |
--- Gibberellic acid |
Kg. |
16% |
|
|
3808 93 40 |
--- Plant growth regulators |
Kg. |
16% |
|
|
3808 93 50 |
--- Weedicides and weed killing agents |
Kg. |
16% |
|
|
3808 93 90 |
-- Other |
Kg. |
16% |
|
|
3808 94 00 |
-- Disinfectants |
Kg. |
16% |
|
3808 99 |
|
-- Other: |
|
|
|
|
3808 99 10 |
--- Pesticides, not else where specified or included |
Kg. |
16% |
|
|
3808 99 90 |
--- Other |
Kg. |
16% |
|
3809 |
|
Finishing agents, dye carriers to accelerate the dyeing or fixing of dye-stuffs and other products and preparations (for example, dressings and mordants), of a kind used in the textile, paper, leather or like industries, not elsewhere specified or included . |
|
|
|
|
3809 10 00 |
- With a basis of amylaceous substances |
Kg. |
20% |
|
|
|
-Other: |
|
|
|
3809 91 |
|
--Of a kind used in the textile or like industries : |
|
|
|
|
3809 91 10 |
--- Textile assistants mordanting agents |
Kg. |
16% |
|
|
3809 91 20 |
--- Textile assistants desizing agents |
Kg. |
16% |
|
|
3809 91 30 |
---Textile assistants dispersing agents |
Kg. |
16% |
|
|
3809 91 40 |
--- Textile assistants emulsifying agents |
Kg. |
16% |
|
|
3809 91 50 |
--- Textile assistants hydro sulphite formaldehyde compound (roungalite or for musul) |
Kg. |
16% |
|
|
3809 91 60 |
--- Textile assistants-textile preservatives |
Kg. |
16% |
|
|
3809 91 70 |
--- Textile assistants water proofing agents |
Kg. |
16% |
|
|
3809 91 80 |
--- Prepared textile glazings, dressings and mordants |
Kg. |
16% |
|
|
3809 91 90 |
--- Other |
Kg. |
16% |
|
|
3809 92 00 |
--Of a kind used in the paper or like industries |
Kg. |
16% |
|
3809 93 |
|
--Of a kind used in the leather or like industries : |
|
|
|
|
3809 93 10 |
--- Fatty oil or pull up oil |
Kg. |
16% |
|
|
3809 93 90 |
--- Other |
Kg. |
16% |
|
|
3809 99 00 |
--Other |
Kg. |
16% |
|
3810 |
|
Pickling preparations for metal surfaces; fluxes and other auxiliary preparations for soldering, brazing or welding; soldering, brazing or Welding powders and pastes consisting of metal and other materials; preparations of a kind used as cores or coatings for welding electrodes or rods |
|
|
|
3810 10 |
|
- Pickling preparations for metal surfaces; soldering, brazing or welding powders and pastes consisting of metal and other materials : |
|
|
|
|
3810 10 10 |
--- Pickling preparations and other soldering, brazing or welding powders or pastes |
Kg. |
16% |
|
|
3810 10 20 |
--- Thermite portion for welding (alumina thermic heat generators) |
Kg. |
16% |
|
|
3810 10 90 |
--- Other |
Kg. |
16% |
|
3810 90 |
|
-Other : |
|
|
|
|
3810 90 10 |
--- Preparations of a kind used as cores or coatings for welding electrodes and rods |
Kg. |
16% |
|
|
3810 90 90 |
--- Other |
Kg. |
16% |
|
3811 |
|
Anti-knock preparations, oxidation inhibitors, gum inhibitors, viscosity improvers, anti-corrosive preparations and other prepared additives, for mineral oils (including gasoline) or for other liquids used for the same purposes as mineral oils |
|
|
|
|
|
- Anti-knock preparations: |
|
|
|
|
3811 11 00 |
--Based on lead compounds |
Kg. |
16% |
|
|
3811 19 00 |
--Other |
Kg. |
16% |
|
|
|
- Additives for lubricating oils: |
|
|
|
|
3811 21 00 |
--Containing petroleum oils or oils obtained from bituminous minerals |
Kg. |
16% |
|
|
3811 29 00 |
--Other |
Kg. |
16% |
|
|
3811 90 00 |
-Other |
Kg. |
16% |
|
3812 |
|
Prepared rubber accelerators; compound plasticisers for rubber or plastics, not elsewhere specified or included; anti-oxidising preparations and other compound stabilisers for rubber or plastics |
|
|
|
|
3812 10 00 |
- Prepared rubber accelerators |
Kg. |
16% |
|
3812 20 |
|
- Compound plasticisers for rubber or plastics : |
|
|
|
|
3812 20 10 |
--- Phthalate plasticisers |
Kg. |
16% |
|
|
3812 20 90 |
--- Other |
Kg. |
16% |
|
3812 30 |
|
- Anti-oxidising preparations and other compound stabilisers for rubber or plastics : |
|
|
|
|
3812 30 10 |
--- Anti-oxidants for rubber |
Kg. |
16% |
|
|
3812 30 20 |
--- Softeners for rubber |
Kg. |
16% |
|
|
3812 30 30 |
--- Vulcansing agents for rubber |
Kg. |
16% |
|
|
3812 30 90 |
--- Other |
Kg. |
16% |
|
3813 |
|
Preparations and charges for fire-extinguishers; charged fire-extinguishing grenades |
Kg. |
16% |
|
3814 |
|
Organic composite solvents and thinners, not elsewhere specified or included; prepared paint or varnish removers |
|
|
|
3814 00 |
|
- Organic composite solvents and thinners, not elsewhere specified or included; prepared paint or varnish removers : |
|
|
|
|
3814 00 10 |
--- Organic composite solvents and thinners, not elsewhere specified or included |
Kg. |
16% |
|
|
3814 00 20 |
--- Prepared paint or varnish removers |
Kg. |
16% |
|
3815 |
|
Reaction initiators, reaction accelerators and catalytic preparations, not elsewhere specified or included |
|
|
|
|
|
- Supported catalysts: |
|
|
|
|
3815 11 00 |
--With nickel or nickel compounds as the active substance |
Kg. |
16% |
|
3815 12 |
|
-- With precious metal or precious metal compounds as me active substance : |
|
|
|
|
3815 12 10 |
--- Platinum or palladium catalysts with a base of activated carbon |
Kg. |
16% |
|
|
3815 12 90 |
--- Other |
Kg. |
16% |
|
|
3815 19 00 |
-- Other |
Kg. |
16% |
|
|
3815 90 00 |
-Other |
Kg. |
16% |
|
3816 00 00 |
|
Refractory cements, mortars, concretes and similar compositions, other than products of Heading No. 38.01 |
Kg. |
16% |
|
3817 |
|
Mixed alkylbenzenes and mixed alkylnaphthalenes, other than those of Heading No. 27.07 or 29.02 |
|
|
|
3817 00 |
|
- Mixed alkylbenzenes and mixed alkylnaphthalenes, other than those of Heading No. 27.07 or 29.02 : |
|
|
|
|
|
--- Mixed alkylbenzenes : |
|
|
|
|
3817 00 11 |
---- Linear alkylbenzenes |
Kg. |
16% |
|
|
3817 00 19 |
---- Other |
Kg. |
16% |
|
|
3817 00 20 |
-Mixed alkylnaphthalenes |
Kg. |
16% |
|
3818 |
|
Chemical elements doped for use in electronics, in the form of discs, wafers or similar forms; chemical compounds doped for use in electronics |
|
|
|
3818 00 |
|
- Chemical elements doped for use in electronics, in the form of discs, wafers or similar forms; chemical compounds doped for use in electronics : |
|
|
|
|
3818 00 10 |
--- Undefused silicon wafers |
Kg. |
16% |
|
|
3818 00 90 |
--- Other |
Kg. |
16% |
|
3819 |
|
Hydraulic brake fluids and other prepared liquids for hydraulic transmission, not containing or containing less than 70% by weight of petroleum oils or oils obtained from bituminous minerals |
|
|
|
|
|
- Hydraulic brake fluids and other prepared liquids for hydraulic transmission, not containing or containing less than 70% by weight of petroleum oils or oils obtained from bituminous minerals : |
|
|
|
|
3819 00 10 |
--- Hydraulic brake fluids |
Kg. |
16% |
|
|
3819 00 90 |
--- Other |
Kg. |
16% |
|
3820 00 00 |
|
Anti-freezing preparations and prepared de-icing fluids |
Kg. |
16% |
|
3821 00 00 |
|
PREPARED CULTURE MEDIA FOR DEVELOPMENT OR MAINTENANCE OF MICRO-ORGANISMS (INCLUDING VIRUSES AND THE LIKE) OR OF PLANT, HUMAN OR ANIMAL CELLS |
Kg. |
16% |
|
3822 |
|
Diagnostic or laboratory reagents on a backing and prepared diagnostic or laboratory reagents whether or not on a backing, other than those of heading No. 30.02 or 30.06 |
|
|
|
3822 00 |
|
- Diagnostic or laboratory reagents on a backing and prepared diagnostic or laboratory reagents whether or not on a backing, other than those of heading No. 30.02 or 30.06 : |
|
|
|
|
|
--- For medical diagnosis : |
|
|
|
|
3822 00 11 |
---- Pregnancy confirmation reagents |
Kg. |
16% |
|
|
3822 00 12 |
---- Reagents for diagnosing AIDS |
Kg. |
16% |
|
|
3822 00 19 |
---- Other |
Kg. |
16% |
|
|
3822 00 90 |
--- Other |
Kg. |
16% |
|
3823 |
|
Industrial Monocarboxylic fatty acids; Acid oils from refining; industrial fatty alcohols |
|
|
|
|
|
- Industrial monocarboxylic fatty acids; acid oils from refining: |
|
|
|
3823 11 |
|
--Stearic acid : |
|
|
|
|
|
--- Palm stearin: |
|
|
|
|
3823 11 11 |
---- Crude |
Kg. |
16% |
|
|
3823 11 12 |
---- RBD |
Kg. |
16% |
|
|
3823 11 19 |
---- Other |
Kg. |
16% |
|
|
3823 11 90 |
--- Other stearic acid or stearin |
Kg. |
16% |
|
|
3823 12 00 |
--Oleic acid |
Kg. |
16% |
|
|
3823 13 00 |
--Tall oil fatty acids |
Kg. |
16% |
|
|
3823 19 00 |
--Other |
Kg. |
16% |
|
3823 70 |
|
- Industrial fatty alcohols : |
|
|
|
|
3823 70 10 |
--- Cetyl alcohol |
Kg. |
16% |
|
|
3823 70 20 |
--- Lauryl alcohol |
Kg. |
16% |
|
|
3823 70 30 |
--- Oleyl alcohol |
Kg. |
16% |
|
|
3823 70 40 |
--- Stearyl alcohol |
Kg. |
16% |
|
|
3823 70 90 |
--- Other |
Kg. |
16% |
|
3824 |
|
Prepared binders for foundry moulds or cores; chemical products and preparations of the chemical or allied industries (including those consisting of mixtures of natural products), not elsewhere specified or included; residual products of the chemical or allied industries, not elsewhere specified or included |
|
|
|
|
3824 10 00 |
- Prepared binders for foundry moulds or cores |
Kg. |
16% |
|
|
3824 30 00 |
- Non-agglomerated metal carbides mixed together or with metallic binders |
Kg. |
16% |
|
3824 40 |
|
- Prepared additives for cements, mortars or concretes : |
|
|
|
|
3824 40 10 |
--- Damp proof or water proof compounds |
Kg. |
16% |
|
|
3824 40 90 |
--- Other |
Kg. |
16% |
|
3824 50 |
|
- Non-refractory mortars and concretes : |
|
|
|
|
3824 50 10 |
--- Concretes ready to use known as "Ready-mix Concrete (RMC)" |
Kg. |
Nil |
|
|
3824 50 90 |
--- Other |
kg. |
16% |
|
3824 60 |
|
- Sorbitol other than that of sub-heading No. 2905.44 : |
|
|
|
|
3824 60 10 |
--- In aqueous solution |
Kg. |
16% |
|
|
3824 60 90 |
--- Other |
Kg. |
16% |
|
|
|
- Mixtures containing halogenated derivatives of methane, ethane or propane: |
|
|
|
|
3824 71 00 |
-- Containing chlorofluorocarbons (CFCs), whether or not containing hydrochlorofluorocarbons (HCFCs), perfluorocarbons (PFCs) or hydrofluorocarbons(HFCs) |
Kg. |
16% |
|
|
3824 72 00 |
-- Containing bromochlorodifluoromethane, bromotrifluoromethane or dibromotetrafluoro-ethanes |
Kg. |
16% |
|
|
3824 73 00 |
-- Containing hydrobromofluorocarbons(HBFCs) |
Kg. |
16% |
|
|
3824 74 00 |
-- Containing hydrochlorofluorocarbons(HCFCs), whether or not containing perfluorocarbons (PFCs) or hydrofluorocarbons (HFCs), but not containing chlorofluorocarbons(CFCs) |
Kg. |
16% |
|
|
3824 75 00 |
-- Containing carbon tetrachloride |
Kg. |
16% |
|
|
3824 76 00 |
-- Containing 1,1,1-trichloroethane (methyl chloroform) |
Kg. |
16% |
|
|
3824 77 00 |
-- Containing bromomethane (methyl bromide) or bromochloromethane |
Kg. |
16% |
|
|
3824 78 00 |
-- Containing perfluorocarbons (PFCs) or hydrofluorocarbons (HFCs), but not containing chlorofluorocarbons (CFCs) or hydrochlorofluorocarbons (HCFCs) |
Kg. |
16% |
|
|
3824 79 00 |
-- Other |
Kg. |
16% |
|
|
|
- Mixtures and preparations containing oxirane (ethylene oxide), polybrominated biphenyls (PBBs), polychlorinated biphenyls (PCBs), polychlorinated terphenyls (PCTs) or tris (2,3-dibromopropyl) phosphate: |
|
|
|
|
3824 81 00 |
-- Containing oxirane (ethylene oxide) |
Kg. |
16% |
|
|
3824 82 00 |
-- Containing polychlorinated biphenyls (PCBs), polychlorinated terphenyls (PCTs) or polybrominated biphenyls (PBBs) |
Kg. |
16% |
|
|
3824 83 00 |
-- Containing tris (2,3-dibromopropyl) phosphate |
Kg. |
16% |
|
3824 90 |
|
-Other : |
|
|
|
|
|
--- Ammoniacal gas liquors and spent oxide produced in coal gas purification, case hardening compound, heat transfer salts; mixture of diphenyl and diphenyl oxide as heat transfer medium, mixed polyethylene glycols; salts for curing or salting, surface tension reducing agents : |
|
|
|
|
3824 90 11 |
---- Ammoniacal gas liquors and spent oxide produced in coal gas purification |
Kg. |
16% |
|
|
3824 90 12 |
---- Case hardening compound |
Kg. |
16% |
|
|
3824 90 13 |
---- Heat transfer salts |
Kg. |
16% |
|
|
3824 90 14 |
---- Mixture of diphenyl and diphenyl oxide as heat transfer medium |
Kg. |
16% |
|
|
3824 90 15 |
---- Mixed polyethylene glycols |
Kg. |
16% |
|
|
3824 90 16 |
---- Salts for curing or salting |
Kg. |
16% |
|
|
3824 90 17 |
---- Surface tension reducing agents |
Kg. |
16% |
|
|
|
--- Electroplating salts; water treatment chemicals; ion exchnager; correcting fluid; precipitated silica and silica gel; oil well chemical : |
|
|
|
|
3824 90 21 |
---- Electroplating salts |
Kg. |
16% |
|
|
3824 90 22 |
---- Water treatment chemicals, ion exchanger (INN) such as permiutits, zeolites) |
Kg. |
16% |
|
|
3824 90 23 |
---- Gramophone records making material |
Kg. |
16% |
|
|
3824 90 24 |
---- Correcting fluid |
Kg. |
16% |
|
|
3824 90 25 |
---- Precipitated silica and silica gel |
Kg. |
16% |
|
|
3824 90 26 |
---- Oil well chemicals |
Kg. |
16% |
|
|
|
--- Mixture containing perhalogenated derivatives of acyclic hydrocarbonscontaining two or more different halogens other than chlorine and fluorine; ferrite powder; capacitor fluids - PCB type; dipping oil for treatment of grapes; Poly brominated biphenyls, poly chlorinated biphenyls, Polychlorinated terphenyls, crocidolite; goods of a kinds known as "hazardous waste"; phosphogypsum : |
|
|
|
|
3824 90 31 |
---- Mixtures containing perhalogenated derivatives of acyclic hydrocarbons containing two or more different halogens other than chlorine and fluorine |
Kg. |
16% |
|
|
3824 90 32 |
---- Ferrite powder |
Kg. |
16% |
|
|
3824 90 33 |
---- Capacitor fluids - PCB type |
Kg. |
16% |
|
|
3824 90 34 |
---- Dipping oil for treatment of grapes |
Kg. |
16% |
|
|
3824 90 35 |
---- Poly brominated biphenyls, poly chlorinated biphenyls, poly chlorinated terphenyls, crocidolite |
Kg. |
16% |
|
|
3824 90 36 |
---- Goods of a kind known as "hazardous waste" |
Kg. |
16% |
|
|
3824 90 37 |
---- Phosphogypsum |
Kg. |
16% |
|
|
3824 90 90 |
--- Other |
Kg. |
16% |
|
3825 |
|
Residual products of the chemical or allied industries, not elsewhere specified or included; municipal waste; sewage sludge; other wastes specified in Note 6 to this chapter |
|
|
|
|
3825 10 00 |
- Municipal waste |
Kg. |
|
|
|
3825 20 00 |
- Sewage sludge |
Kg. |
|
|
|
3825 30 00 |
- Clinical waste |
Kg. |
|
|
|
|
- Waste organic solvents : |
|
|
|
|
3825 41 00 |
-- Halogenated |
Kg. |
16% |
|
|
3825 49 00 |
-- Other |
Kg. |
16% |
|
|
3825 50 00 |
-- Wastes of metal pickling liquors, hydraulic fluids, brake fluids and antifreeze fluids |
Kg. |
16% |
|
|
|
- Other wastes from chemical or allied industries : |
|
|
|
|
3825 61 00 |
-- Mainly containing organic constituents |
Kg. |
16% |
|
|
3825 69 00 |
-- Other |
Kg. |
16% |
|
|
3825 90 00 |
- Other |
Kg. |
16% |