Central Excise Tariff 2006-07
Chapter 38
|
Heading No. |
Description of article |
Unit |
Rate of duty |
|
|
(1) |
|
(2) |
(3) |
(4) |
| 3801 | Artificial graphite; colloidal or semi-colloidal graphite; preparations based on graphite or other carbon in the form of pastes, blocks, plates or other semi-manufactures | |||
| 3801 10 00 | - Artificial graphite | Kg. | 16% | |
| 3801 20 00 | - Colloidal or semi-colloidal graphite | Kg. | 16% | |
| 3801 30 00 | - Carbonaceous pastes for electrodes and similar pastes for furnace linings | Kg. | 16% | |
| 3801 90 00 | -Other | Kg. | 16% | |
| 3802 | Activated carbon; activated natural mineral products; animal black, including spent animal black | |||
| 3802 10 00 | - Activated carbon | Kg. | 16% | |
| 3802 90 | -Other : | |||
| --- Activated natural mineral products : | ||||
| 3802 90 11 | ---- Activated alumina | Kg. | 16% | |
| 3802 90 12 | ---- Activted bauxite | Kg. | 16% | |
| 3802 90 19 | ---- Other | Kg. | 16% | |
| 3802 90 20 | --- Animal black (for example bone black, ivory black), including spent animal black | Kg. | 16% | |
| 3803 00 00 | Tall oil, whether or not refined | Kg. | 16% | |
| 3804 | Residual lyes from the manufacture of wood pulp,whether or not concentrated, desugared or chemically treated, including lignin sulphonates, but excluding tall oil of Heading No. 3803 | |||
| 3804 00 | - Residual lyes from the manufacture of wood pulp,whether or not concentrated, desugared or chemically treated, including lignin sulphonates, but excluding tall oil of Heading No. 3803 : | |||
| 3804 00 10 | --- Lignin sulphonates | Kg. | 16% | |
| 3804 00 20 | --- Concentrated sulphate lye | Kg. | 16% | |
| 3804 00 90 | --- Other | Kg. | 16% | |
| 3805 | Gum, wood or sulphate turpentine and other terpenic oils produced by the distillation or other treatment of coniferous woods; crude dipentene; sulphite turpentine and other crude para-cymene; pine oil containing alpha-terpineol as the main constituent | |||
| 3805 10 | - Gum, wood or sulphate turpentine oils : | |||
| 3805 10 10 | --- Wood turpentine oil and spirit of turpentine | Kg. | 16% | |
| 3805 10 20 | --- Gum turpentine oil | Kg. | 16% | |
| 3805 10 30 | --- Sulphate turpentine oil | Kg. | 16% | |
|
1Omitted [3805 20 00 |
- Pine oil | Kg. | 16%] | |
| 3805 90 | - Other : | |||
| 3805 90 10 | --- Terpenic oils produced by the distillation or other treatment of coniferous woods | Kg. | 16% | |
| 3805 90 20 | --- Crude dipentene | Kg. | 16% | |
| 3805 90 30 | --- Sulphite turpentine | Kg. | 16% | |
| 3805 90 90 | --- Other | Kg. | 16% | |
| 3806 | Rosin and resin acids, and derivatives thereof; rosin spirit and rosin oils; run gums | |||
| 3806 10 | - Rosin and resin acids : | |||
| 3806 10 10 | --- Gum rosin | Kg. | 16% | |
| 3806 10 90 | --- Other | Kg. | 16% | |
| 3806 20 00 | - Salts of rosin, of resin acids or of derivatives of rosin or resin acids, other than salts of rosin adducts | Kg. | 16% | |
| 3806 30 00 | - Easter gums | Kg. | 16% | |
| 3806 90 | - Other : | |||
| 3806 90 10 | -- Run gums | Kg. | 16% | |
| 3806 90 90 | -- Other | Kg. | 16% | |
| 3807 | Wood tar; wood tar oils; wood creosote, wood naphtha; vegetable pitch; brewers' pitch and similar preparations based on rosin, resin acids or on vegetable pitch | |||
| 3807 00 | - Wood tar; wood tar oils; wood creosote, wood naphtha; vegetable pitch; brewers' pitch and similar preparations based on rosin, resin acids or on vegetable pitch : | |||
| 3807 00 10 | --- Wood tar | Kg. | 16% | |
| 3807 00 20 | --- Wood tar oils, wood creosote, wood naphtha | Kg. | 16% | |
| 3807 00 30 | --- Vegetable pitch, brewers' pitch and similar preparations based on rosin, resin acids or vegetable pitch | Kg. | 16% | |
| 3808 | Insecticides, rodenticides, fungicides, herbicides, anti-sprouting products and plant-growth regulators, disinfectants and similar products, put up in forms or packings for retail sale or as preparations or articles (for example, sulphur- treated bands, wicks and candles, and fly-papers) | |||
| 1[3808 50 |
Goods specified in Sub-heading Note 1 to this Chapter, namely:— aldrin (ISO); binapacryI (ISO); camphechlor (ISO) (toxaphene); captafol (ISO); chlordane (ISO); chlordimeform (ISO); chlorobenzilate (ISO);DDT (ISO) (clofenotane (INN), 1,1,1-trichloro-2,2- bis(pchlorphenyl) ethane); dieldrin (ISO,INN), dinoseb (ISO), its salts or its esters; ethylene dibromide (ISO) (1,2-dibromoethane); ethylene dichloride(ISO) (1,2-dichloroethane); fluoroacetamide (ISO); heptachlor (ISO); hexachlorobenzene (ISO); 1,2,3,4,5,6 – exachlorocyclohexane (HCH (ISO)), including lindane (ISO, INN); mercury compounds; methamidophos (ISO); monocrotophos (ISO); oxirane (ethylene oxide); parathion (ISO); parathion-methyl (ISO) (methyl-parathion); pentachlorophenol (ISO); phosphamidon (ISO); 2,4,5-T (ISO) (2,4,5-trichlorophenoxyacetic acid), its salts or its esters: |
|||
| 3808 50 00 | - Aldrin (ISO); binapacryI (ISO); camphechlor (ISO) (toxaphene); captafol (ISO); chlordane (ISO); chlordimeform (ISO); chlorobenzilate (ISO);DDT (ISO) (clofenotane (INN), 1,1,1-trichloro-2,2- bis(pchlorphenyl) ethane); dieldrin (ISO,INN), dinoseb (ISO), its salts or its esters; ethylene dibromide (ISO) (1,2-dibromoethane); ethylene dichloride(ISO) (1,2-dichloroethane); fluoroacetamide (ISO); heptachlor (ISO); hexachlorobenzene (ISO); 1,2,3,4,5,6 – exachlorocyclohexane (HCH (ISO)), including lindane (ISO, INN); mercury compounds; methamidophos (ISO); monocrotophos (ISO); oxirane (ethylene oxide); parathion (ISO); parathion-methyl (ISO) (methyl-parathion); pentachlorophenol (ISO); phosphamidon (ISO); 2,4,5-T (ISO) (2,4,5-trichlorophenoxyacetic acid), its salts or its esters | Kg. | 16% | |
| - Other: | ||||
| 3808 91 | -- Insecticides: | |||
| 3808
91 11
|
---- Aluminium phosphite (for example phostoxin) | Kg. | 16% | |
| 3808 91 12 | ---- Calcium cyanide | Kg. | 16% | |
| 3808 91 13 | ---- D.D.V.P. | Kg. | 16% | |
| 3808 91 21 | ---- Diaginal | Kg. | 16% | |
| 3808 91 22 | ---- Methyl bromide | Kg. | 16% | |
| 3808 91 23 | ---- Dimethoate, technical grade | Kg. | 16% | |
| 3808 91 24 | ---- Melathion | Kg. | 16% | |
| 3808 91 31 | ---- Endosulphan, technical grade | Kg. | 16% | |
| 3808 91 32 | ---- Quinal phos | Kg. | 16% | |
| 3808 91 33 | ---- Isoproturon | Kg. | 16% | |
| 3808 91 34 | ---- Fenthion | Kg. | 16% | |
| 3808 91 35 | ---- Cipermethrin, technical grade | Kg. | 16% | |
| 3808 91 36 | ---- Allethrin | Kg. | 16% | |
| 3808 91 37 | ---- Synthetic pyrethrum | Kg. | 16% | |
| -- Other: | ||||
| 3808 91 91 | ---- Repellants for insects such as flies, mosquito | Kg. | 16% | |
| 3808 91 92 | ---- Paper impregnated or coated with insecticides such as D.D.T. coated paper | Kg. | 16% | |
| 3808 91 99 | --- Other | Kg. | 16% | |
| 3808 92 | -- Fungicides: | |||
| 3808 92 10 | --- Maneb | Kg. | 16% | |
| 3808 92 20 | --- Sodium penta chlorophenate (santrobrite) | Kg. | 16% | |
| 3808 92 30 | --- Thiram (tetramethyl thiuram disulphide) | Kg. | 16% | |
| 3808 92 40 | --- Zineb | Kg. | 16% | |
| 3808 92 50 | --- Copper oxychloride | Kg. | 16% | |
| 3808 92 90 | --- Other | Kg. | 16% | |
| 3808 93 | -- Herbicides, anti-sprouting products and plant-growth regulators: | |||
| 3808 93 10 | --- Chloromethyl phenozy acetic acid (M.C.P.A) | Kg. | 16% | |
| 3808 93 20 | --- 2:4 Dichloro phenoy acetic acid and its esters | Kg. | 16% | |
| 3808 93 30 | --- Gibberellic acid | Kg. | 16% | |
| 3808 93 40 | --- Plant growth regulators | Kg. | 16% | |
| 3808 93 50 | --- Weedicides and weed killing agents | Kg. | 16% | |
| 3808 93 90 | -- Other | Kg. | 16% | |
| 3808 94 00 | -- Disinfectants | Kg. | 16% | |
| 3808 99 | -- Other: | |||
| 3808 99 10 | --- Pesticides, not else where specified or included | Kg. | 16% | |
| 3808 99 90 | --- Other | Kg. | 16%] | |
| Old[3808 10 | - Insecticides : | |||
| --- Aldrin, aluminium phosphite, calcium cyanide, chlordane, chloro benzilate, DDVP, DDT : | ||||
| 3808 10 11 | ---- Aldrin | Kg. | 16% | |
| 3808 10 12 | ---- Aluminium phosphite (for example phostoxin) | Kg. | 16% | |
| 3808 10 13 | ---- Calcium cyanide | Kg. | 16% | |
| 3808 10 14 | ---- Chlordane | Kg. | 16% | |
| 3808 10 15 | ---- Chloro benzilate | Kg. | 16% | |
| 3808 10 16 | ---- D.D.V.P. (Dimethyl-dichloro-vinyl-hosphate) | Kg. | 16% | |
| 3808 10 17 | ---- D.D.T. (excluding D.D.T. of heading 2903 62) | Kg. | 16% | |
| --- Diaginal, heptachlor, lindane, methyl bromide, parathion methyl, dimethoate technical, malathion : | ||||
| 3808 10 21 | ---- Diaginal | Kg. | 16% | |
| 3808 10 22 | ---- Heptachlor | Kg. | 16% | |
| 3808 10 23 | ---- Lindane | Kg. | 16% | |
| 3808 10 24 | ---- Methyl bromide | Kg. | 16% | |
| 3808 10 25 | ---- Parathion, methyl | Kg. | 16% | |
| 3808 10 26 | ---- Dimethoate, technical grade | Kg. | 16% | |
| 3808 10 27 | ---- Malathion | Kg. | 16% | |
| --- Endosulphan technical, quinal phos, isoproturon, fenthion, cipermethrin technical, allethrin, synthetic pyrethrum : | ||||
| 3808 10 31 | ---- Endosulphan, technical grade | Kg. | 16% | |
| 3808 10 32 | ---- Quinal phos | Kg. | 16% | |
| 3808 10 33 | ---- Isoproturon | Kg. | 16% | |
| 3808 10 34 | ---- Fenthion | Kg. | 16% | |
| 3808 10 35 | ---- Cipermethrin, technical grade | Kg. | 16% | |
| 3808 10 36 | ---- Allethrin | Kg. | 16% | |
| 3808 10 37 | ---- Synthetic pyrethrum | Kg. | 16% | |
| --- Other : | ||||
| 3808 10 91 | ---- Repellants for insects such as flies, mosquito | Kg. | 16% | |
| 3808 10 92 | ---- Paper impregnated or coated with insecticide such as D.D.T. coated paper | Kg. | 16% | |
| 3808 10 99 | ---- Other | Kg. | 16% | |
| 3808 20 | - Fungicides : | |||
| 3808 20 10 | --- Maneb | Kg. | 16% | |
| 3808 20 20 | --- Sodium penta chlorophenate (santobrite) | Kg. | 16% | |
| 3808 20 30 | --- Thiram (tetramethyl thiuram disulphide) | Kg. | 16% | |
| 3808 20 40 | --- Zineb | Kg. | 16% | |
| 3808 20 50 | --- Copper oxychloride | Kg. | 16% | |
| 3808 20 90 | --- Other | Kg. | 16% | |
| 3808 30 | - Herbicides, anti-sprouting products and plant-growth regulators : | |||
| 3808 30 10 | --- Chloromethyl phenozy acetic acid (M.C.P.A.) | Kg. | 16% | |
| 3808 30 20 | --- 2:4 Dichlorophenozy acetic acid and its esters | Kg. | 16% | |
| 3808 30 30 | --- Gibberellic acid | Kg. | 16% | |
| 3808 30 40 | --- Plant-growth regulators | Kg. | 16% | |
| 3808 30 50 | --- Weedicides and weed killing agents | Kg. | 16% | |
| 3808 30 90 | --- Other | Kg. | 16% | |
| 3808 40 00 | -Disinfectants | Kg. | 16% | |
| 3808 90 | -Other : | |||
| 3808 90 10 | --- Pesticides, not elsewhere specified or included | Kg. | 16% | |
| 3808 90 90 | --- Other | Kg. | 16%] | |
| 3809 | Finishing agents, dye carriers to accelerate the dyeing or fixing of dye-stuffs and other products and preparations (for example, dressings and mordants), of a kind used in the textile, paper, leather or like industries, not elsewhere specified or included . | |||
| 3809 10 00 | - With a basis of amylaceous substances | Kg. | 16% | |
| -Other: | ||||
| 3809 91 | --Of a kind used in the textile or like industries : | |||
| 3809 91 10 | --- Textile assistants mordanting agents | Kg. | 16% | |
| 3809 91 20 | --- Textile assistants desizing agents | Kg. | 16% | |
| 3809 91 30 | ---Textile assistants dispersing agents | Kg. | 16% | |
| 3809 91 40 | --- Textile assistants emulsifying agents | Kg. | 16% | |
| 3809 91 50 | --- Textile assistants hydro sulphite formaldehyde compound (roungalite or for musul) | Kg. | 16% | |
| 3809 91 60 | --- Textile assistants-textile preservatives | Kg. | 16% | |
| 3809 91 70 | --- Textile assistants water proofing agents | Kg. | 16% | |
| 3809 91 80 | --- Prepared textile glazings, dressings and mordants | Kg. | 16% | |
| 3809 91 90 | --- Other | Kg. | 16% | |
| 3809 92 00 | --Of a kind used in the paper or like industries | Kg. | 16% | |
| 3809 93 | --Of a kind used in the leather or like industries : | |||
| 3809 93 10 | --- Fatty oil or pull up oil | Kg. | 16% | |
| 3809 93 90 | --- Other | Kg. | 16% | |
| 3809 99 00 | --Other | Kg. | 16% | |
| 3810 | Pickling preparations for metal surfaces; fluxes and other auxiliary preparations for soldering, brazing or welding; soldering, brazing or Welding powders and pastes consisting of metal and other materials; preparations of a kind used as cores or coatings for welding electrodes or rods | |||
| 3810 10 | - Pickling preparations for metal surfaces; soldering, brazing or welding powders and pastes consisting of metal and other materials : | |||
| 3810 10 10 | --- Pickling preparations and other soldering, brazing or welding powders or pastes | Kg. | 16% | |
| 3810 10 20 | --- Thermite portion for welding (alumina thermic heat generators) | Kg. | 16% | |
| 3810 10 90 | --- Other | Kg. | 16% | |
| 3810 90 | -Other : | |||
| 3810 90 10 | --- Preparations of a kind used as cores or coatings for welding electrodes and rods | Kg. | 16% | |
| 3810 90 90 | --- Other | Kg. | 16% | |
| 3811 | Anti-knock preparations, oxidation inhibitors, gum inhibitors, viscosity improvers, anti-corrosive preparations and other prepared additives, for mineral oils (including gasoline) or for other liquids used for the same purposes as mineral oils | |||
| - Anti-knock preparations: | ||||
| 3811 11 00 | --Based on lead compounds | Kg. | 16% | |
| 3811 19 00 | --Other | Kg. | 16% | |
| - Additives for lubricating oils: | ||||
| 3811 21 00 | --Containing petroleum oils or oils obtained from bituminous minerals | Kg. | 16% | |
| 3811 29 00 | --Other | Kg. | 16% | |
| 3811 90 00 | -Other | Kg. | 16% | |
| 3812 | Prepared rubber accelerators; compound plasticisers for rubber or plastics, not elsewhere specified or included; anti-oxidising preparations and other compound stabilisers for rubber or plastics | |||
| 3812 10 00 | - Prepared rubber accelerators | Kg. | 16% | |
| 3812 20 | - Compound plasticisers for rubber or plastics : | |||
| 3812 20 10 | --- Phthalate plasticisers | Kg. | 16% | |
| 3812 20 90 | --- Other | Kg. | 16% | |
| 3812 30 | - Anti-oxidising preparations and other compound stabilisers for rubber or plastics : | |||
| 3812 30 10 | --- Anti-oxidants for rubber | Kg. | 16% | |
| 3812 30 20 | --- Softeners for rubber | Kg. | 16% | |
| 3812 30 30 | --- Vulcansing agents for rubber | Kg. | 16% | |
| 3812 30 90 | --- Other | Kg. | 16% | |
| 3813 | Preparations and charges for fire-extinguishers; charged fire-extinguishing grenades | Kg. | 16% | |
| 3814 | Organic composite solvents and thinners, not elsewhere specified or included; prepared paint or varnish removers | |||
| 3814 00 | - Organic composite solvents and thinners, not elsewhere specified or included; prepared paint or varnish removers : | |||
| 3814 00 10 | --- Organic composite solvents and thinners, not elsewhere specified or included | Kg. | 16% | |
| 3814 00 20 | --- Prepared paint or varnish removers | Kg. | 16% | |
| 3815 | Reaction initiators, reaction accelerators and catalytic preparations, not elsewhere specified or included | |||
| - Supported catalysts: | ||||
| 3815 11 00 | --With nickel or nickel compounds as the active substance | Kg. | 16% | |
| 3815 12 | -- With precious metal or precious metal compounds as me active substance : | |||
| 3815 12 10 | --- Platinum or palladium catalysts with a base of activated carbon | Kg. | 16% | |
| 3815 12 90 | --- Other | Kg. | 16% | |
| 3815 19 00 | -- Other | Kg. | 16% | |
| 3815 90 00 | -Other | Kg. | 16% | |
| 3816 00 00 | Refractory cements, mortars, concretes and similar compositions, other than products of Heading No. 38.01 | Kg. | 16% | |
| 3817 | Mixed alkylbenzenes and mixed alkylnaphthalenes, other than those of Heading No. 27.07 or 29.02 | |||
| 3817 00 | - Mixed alkylbenzenes and mixed alkylnaphthalenes, other than those of Heading No. 27.07 or 29.02 : | |||
| --- Mixed alkylbenzenes : | ||||
| 3817 00 11 | ---- Linear alkylbenzenes | Kg. | 16% | |
| 3817 00 19 | ---- Other | Kg. | 16% | |
| 3817 00 20 | -Mixed alkylnaphthalenes | Kg. | 16% | |
| 3818 | Chemical elements doped for use in electronics, in the form of discs, wafers or similar forms; chemical compounds doped for use in electronics | |||
| 3818 00 | - Chemical elements doped for use in electronics, in the form of discs, wafers or similar forms; chemical compounds doped for use in electronics : | |||
| 3818 00 10 | --- Undefused silicon wafers | Kg. | 16% | |
| 3818 00 90 | --- Other | Kg. | 16% | |
| 3819 | Hydraulic brake fluids and other prepared liquids for hydraulic transmission, not containing or containing less than 70% by weight of petroleum oils or oils obtained from bituminous minerals | |||
| - Hydraulic brake fluids and other prepared liquids for hydraulic transmission, not containing or containing less than 70% by weight of petroleum oils or oils obtained from bituminous minerals : | ||||
| 3819 00 10 | --- Hydraulic brake fluids | Kg. | 16% | |
| 3819 00 90 | --- Other | Kg. | 16% | |
| 3820 00 00 | Anti-freezing preparations and prepared de-icing fluids | Kg. | 16% | |
| 3821 00 00 | 1[PREPARED
CULTURE MEDIA FOR DEVELOPMENT OR MAINTENANCE OF
MICRO-ORGANISMS (INCLUDING VIRUSES AND THE LIKE) OR OF PLANT,
HUMAN OR ANIMAL CELLS]
Old[Prepared culture media for development of micro-organisms] |
Kg. | 16% | |
| 3822 | Diagnostic or laboratory reagents on a backing and prepared diagnostic or laboratory reagents whether or not on a backing, other than those of heading No. 30.02 or 30.06 | |||
| 3822 00 | - Diagnostic or laboratory reagents on a backing and prepared diagnostic or laboratory reagents whether or not on a backing, other than those of heading No. 30.02 or 30.06 : | |||
| --- For medical diagnosis : | ||||
| 3822 00 11 | ---- Pregnancy confirmation reagents | Kg. | 16% | |
| 3822 00 12 | ---- Reagents for diagnosing AIDS | Kg. | 16% | |
| 3822 00 19 | ---- Other | Kg. | 16% | |
| 3822 00 90 | --- Other | Kg. | 16% | |
| 3823 | Industrial Monocarboxylic fatty acids; Acid oils from refining; industrial fatty alcohols | |||
| - Industrial monocarboxylic fatty acids; acid oils from refining: | ||||
| 3823 11 | --Stearic acid : | |||
| --- Palm stearin: | ||||
| 3823 11 11 | ---- Crude | Kg. | 16% | |
| 3823 11 12 | ---- RBD | Kg. | 16% | |
| 3823 11 19 | ---- Other | Kg. | 16% | |
| 3823 11 90 | --- Other stearic acid or stearin | Kg. | 16% | |
| 3823 12 00 | --Oleic acid | Kg. | 16% | |
| 3823 13 00 | --Tall oil fatty acids | Kg. | 16% | |
| 3823 19 00 | --Other | Kg. | 16% | |
| 3823 70 | - Industrial fatty alcohols : | |||
| 3823 70 10 | --- Cetyl alcohol | Kg. | 16% | |
| 3823 70 20 | --- Lauryl alcohol | Kg. | 16% | |
| 3823 70 30 | --- Oleyl alcohol | Kg. | 16% | |
| 3823 70 40 | --- Stearyl alcohol | Kg. | 16% | |
| 3823 70 90 | --- Other | Kg. | 16% | |
| 3824 | Prepared binders for foundry moulds or cores; chemical products and preparations of the chemical or allied industries (including those consisting of mixtures of natural products), not elsewhere specified or included; residual products of the chemical or allied industries, not elsewhere specified or included | |||
| 3824 10 00 | - Prepared binders for foundry moulds or cores | Kg. | 16% | |
| 1Omitted [3824 20 | - Naphthenic acids, their water-insoluble salts and their esters : | |||
| 3824 20 10 | --- Copper naphthenate | Kg. | 16% | |
| 3824 20 20 | --- Naphthenic acids | Kg. | 16% | |
| 3824 20 90 | --- Other | Kg. | 16%] | |
| 3824 30 00 | - Non-agglomerated metal carbides mixed together or with metallic binders | Kg. | 16% | |
| 3824 40 | - Prepared additives for cements, mortars or concretes : | |||
| 3824 40 10 | --- Damp proof or water proof compounds | Kg. | 16% | |
| 3824 40 90 | --- Other | Kg. | 16% | |
| 3824 50 | - Non-refractory mortars and concretes : | |||
| 3824 50 10 | --- Concretes ready to use known as "Ready-mix Concrete (RMC)" | Kg. | Nil | |
| 3824 50 90 | --- Other | Kg. | 16% | |
| 3824 60 | - Sorbitol other than that of sub-heading No. 2905.44 : | |||
| 3824 60 10 | --- In aqueous solution | Kg. | 16% | |
| 1[3824 60 90 | --- Other | Kg. | 16% | |
| - Mixtures containing halogenated derivatives of methane, ethane or propane: | ||||
| 3824 71 00 | -- Containing chlorofluorocarbons (CFCs), whether or not containing hydrochlorofluorocarbons (HCFCs), perfluorocarbons (PFCs) or hydrofluorocarbons(HFCs) | Kg. | 16% | |
| 3824 72 00 | -- Containing bromochlorodifluoromethane, bromotrifluoromethane or dibromotetrafluoro-ethanes | Kg. | 16% | |
| 3824 73 00 | -- Containing hydrobromofluorocarbons(HBFCs) | Kg. | 16% | |
| 3824 74 00 | -- Containing hydrochlorofluorocarbons(HCFCs), whether or not containing perfluorocarbons (PFCs) or hydrofluorocarbons (HFCs), but not containing chlorofluorocarbons(CFCs) | Kg. | 16% | |
| 3824 75 00 | -- Containing carbon tetrachloride | Kg. | 16% | |
| 3824 76 00 | -- Containing 1,1,1-trichloroethane (methyl chloroform) | Kg. | 16% | |
| 3824 77 00 | -- Containing bromomethane (methyl bromide) or bromochloromethane | Kg. | 16% | |
| 3824 78 00 | -- Containing perfluorocarbons (PFCs) or hydrofluorocarbons (HFCs), but not containing chlorofluorocarbons (CFCs) or hydrochlorofluorocarbons (HCFCs) | Kg. | 16% | |
| 3824 79 00 | -- Other | Kg. | 16% | |
| - Mixtures and preparations containing oxirane (ethylene oxide), polybrominated biphenyls (PBBs), polychlorinated biphenyls (PCBs), polychlorinated terphenyls (PCTs) or tris (2,3-dibromopropyl) phosphate: | ||||
| 3824 81 00 | -- Containing oxirane (ethylene oxide) | Kg. | 16% | |
| 3824 82 00 | -- Containing polychlorinated biphenyls (PCBs), polychlorinated terphenyls (PCTs) or polybrominated biphenyls (PBBs) | Kg. | 16% | |
| 3824 83 00 | -- Containing tris (2,3-dibromopropyl) phosphate | Kg. | 16%] | |
| Old[3824 60 90 | --- Other | Kg. | 16% | |
| - Mixtures containing perhalogenated derivatives of acyclic hydrocarbons containing two or more different halogens: | ||||
| 3824 71 | --Containing acyclic hydrocarbons perhalogenated only with flourine and chlorine : | |||
| 3824 71 10 | --- Containing ozone depleting substances | Kg. | 16% | |
| 3824 71 90 | --- Other | Kg. | 16% | |
| 3824 79 | --Other : | |||
| 3824 79 10 | --- Containing ozone depleting substances | Kg. | 16% | |
| 3824 79 90 | --- Other | Kg. | 16%] | |
| 3824 90 | -Other : | |||
| --- Ammoniacal gas liquors and spent oxide produced in coal gas purification, case hardening compound, heat transfer salts; mixture of diphenyl and diphenyl oxide as heat transfer medium, mixed polyethylene glycols; salts for curing or salting, surface tension reducing agents : | ||||
| 3824 90 11 | ---- Ammoniacal gas liquors and spent oxide produced in coal gas purification | Kg. | 16% | |
| 3824 90 12 | ---- Case hardening compound | Kg. | 16% | |
| 3824 90 13 | ---- Heat transfer salts | Kg. | 16% | |
| 3824 90 14 | ---- Mixture of diphenyl and diphenyl oxide as heat transfer medium | Kg. | 16% | |
| 3824 90 15 | ---- Mixed polyethylene glycols | Kg. | 16% | |
| 3824 90 16 | ---- Salts for curing or salting | Kg. | 16% | |
| 3824 90 17 | ---- Surface tension reducing agents | Kg. | 16% | |
| --- Electroplating salts; water treatment chemicals; ion exchnager; correcting fluid; precipitated silica and silica gel; oil well chemical : | ||||
| 3824 90 21 | ---- Electroplating salts | Kg. | 16% | |
| 3824 90 22 | ---- Water treatment chemicals, ion exchanger (INN) such as permiutits, zeolites) | Kg. | 16% | |
| 3824 90 23 | ---- Gramophone records making material | Kg. | 16% | |
| 3824 90 24 | ---- Correcting fluid | Kg. | 16% | |
| 3824 90 25 | ---- Precipitated silica and silica gel | Kg. | 16% | |
| 3824 90 26 | ---- Oil well chemicals | Kg. | 16% | |
| --- Mixture containing perhalogenated derivatives of acyclic hydrocarbonscontaining two or more different halogens other than chlorine and fluorine; ferrite powder; capacitor fluids - PCB type; dipping oil for treatment of grapes; Poly brominated biphenyls, poly chlorinated biphenyls, Polychlorinated terphenyls, crocidolite; goods of a kinds known as "hazardous waste"; phosphogypsum : | ||||
| 3824 90 31 | ---- Mixtures containing perhalogenated derivatives of acyclic hydrocarbons containing two or more different halogens other than chlorine and fluorine | Kg. | 16% | |
| 3824 90 32 | ---- Ferrite powder | Kg. | 16% | |
| 3824 90 33 | ---- Capacitor fluids - PCB type | Kg. | 16% | |
| 3824 90 34 | ---- Dipping oil for treatment of grapes | Kg. | 16% | |
| 3824 90 35 | ---- Poly brominated biphenyls, poly chlorinated biphenyls, poly chlorinated terphenyls, crocidolite | Kg. | 16% | |
| 3824 90 36 | ---- Goods of a kind known as "hazardous waste" | Kg. | 16% | |
| 3824 90 37 | ---- Phosphogypsum | Kg. | 16% | |
| 3824 90 90 | --- Other | Kg. | 16% | |
| 3825 | Residual products of the chemical or allied industries, not elsewhere specified or included; municipal waste; sewage sludge; other wastes specified in Note 6 to this chapter | |||
| 3825 10 00 | - Municipal waste | Kg. | ||
| 3825 20 00 | - Sewage sludge | Kg. | ||
| 3825 30 00 | - Clinical waste | Kg. | ||
| - Waste organic solvents : | ||||
| 3825 41 00 | -- Halogenated | Kg. | 16% | |
| 3825 49 00 | -- Other | Kg. | 16% | |
| 3825 50 00 | -- Wastes of metal pickling liquors, hydraulic fluids, brake fluids and antifreeze fluids | Kg. | 16% | |
| - Other wastes from chemical or allied industries : | ||||
| 3825 61 00 | -- Mainly containing organic constituents | Kg. | 16% | |
| 3825 69 00 | -- Other | Kg. | 16% | |
| 3825 90 00 | - Other | Kg. | 16% | |
1. Changes w.e.f. 1-Jan-2007, as per the Seventh Schedule of Finance Bill 2006.